C26H34O4 — CID 57262576
[(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-1,2-dimethylidene-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 57262576) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-1,2-dimethylidene-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-1,2-dimethylidene-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 57262576 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-1,2-dimethylidene-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C=C1C(=C)[C@@]2(C)C(=CC1=O)C(C)C[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C26H34O4/c1-14-12-19-20-9-11-26(17(4)27,30-18(5)28)24(20,6)10-8-21(19)25(7)16(3)15(2)23(29)13-22(14)25/h13-14,19-21H,2-3,8-12H2,1,4-7H3/t14?,19-,20-,21-,24-,25+,26-/m0/s1 |
| InChIKey | XWIGEKNDZGRJMM-XLZAOTRSSA-N |
| XLogP | 4.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|