C27H43NO4Si — CID 20845915
[(3E,8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-trimethylsilyloxyimino-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 20845915) has the molecular formula C27H43NO4Si and a molecular weight of 473.73 g/mol. Its IUPAC name is [(3E,8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-trimethylsilyloxyimino-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3E,8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-trimethylsilyloxyimino-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 20845915 |
| Molecular Formula | C27H43NO4Si |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | [(3E,8R,9S,10R,13S,14S,17R)-17-acetyl-6,10,13-trimethyl-3-trimethylsilyloxyimino-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3CC(C)C4=C/C(=N/O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H43NO4Si/c1-17-15-21-22(25(4)12-9-20(16-24(17)25)28-32-33(6,7)8)10-13-26(5)23(21)11-14-27(26,18(2)29)31-19(3)30/h16-17,21-23H,9-15H2,1-8H3/b28-20+/t17?,21-,22+,23+,25-,26+,27+/m1/s1 |
| InChIKey | YZUBWERZJYEHKK-XSSFGFDWSA-N |
| XLogP | 6.29 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|