C28H45NO5Si — CID 20845929
[(3Z,8R,9S,10R,13S,14S,17R)-17-acetyl-3-methoxyimino-6,10,13-trimethyl-6-trimethylsilyloxy-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 20845929) has the molecular formula C28H45NO5Si and a molecular weight of 503.76 g/mol. Its IUPAC name is [(3Z,8R,9S,10R,13S,14S,17R)-17-acetyl-3-methoxyimino-6,10,13-trimethyl-6-trimethylsilyloxy-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3Z,8R,9S,10R,13S,14S,17R)-17-acetyl-3-methoxyimino-6,10,13-trimethyl-6-trimethylsilyloxy-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 20845929 |
| Molecular Formula | C28H45NO5Si |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | [(3Z,8R,9S,10R,13S,14S,17R)-17-acetyl-3-methoxyimino-6,10,13-trimethyl-6-trimethylsilyloxy-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CO/N=C1\C=C2C(C)(O[Si](C)(C)C)C[C@@H]3[C@H](CC[C@@]4(C)[C@H]3CC[C@]4(OC(C)=O)C(C)=O)[C@@]2(C)CC1 |
| InChI | InChI=1S/C28H45NO5Si/c1-18(30)28(33-19(2)31)15-12-23-21-17-27(5,34-35(7,8)9)24-16-20(29-32-6)10-13-25(24,3)22(21)11-14-26(23,28)4/h16,21-23H,10-15,17H2,1-9H3/b29-20-/t21-,22+,23+,25-,26+,27?,28+/m1/s1 |
| InChIKey | IOAZSQWRGGKIQW-HYIYJRERSA-N |
| XLogP | 6.06 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|