C23H27ClO3 — CID 57084919
(8R,9S,10S,13S,14S,17R)-17-acetyl-6-chloro-17-hydroxy-10,13-dimethyl-1,2-dimethylidene-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-one (PubChem CID 57084919) has the molecular formula C23H27ClO3 and a molecular weight of 386.92 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17R)-17-acetyl-6-chloro-17-hydroxy-10,13-dimethyl-1,2-dimethylidene-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10S,13S,14S,17R)-17-acetyl-6-chloro-17-hydroxy-10,13-dimethyl-1,2-dimethylidene-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57084919 |
| Molecular Formula | C23H27ClO3 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (8R,9S,10S,13S,14S,17R)-17-acetyl-6-chloro-17-hydroxy-10,13-dimethyl-1,2-dimethylidene-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C(=C)[C@@]2(C)C(=CC1=O)C(Cl)=C[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(O)C(C)=O |
| InChI | InChI=1S/C23H27ClO3/c1-12-13(2)22(5)17-6-8-21(4)16(7-9-23(21,27)14(3)25)15(17)10-19(24)18(22)11-20(12)26/h10-11,15-17,27H,1-2,6-9H2,3-5H3/t15-,16-,17-,21-,22+,23-/m0/s1 |
| InChIKey | WPVZAXNHTHKCBP-BZMASMNQSA-N |
| XLogP | 4.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|