C23H29ClO2 — CID 58233822
1-[(2S,15R,16S)-9-chloro-15-hydroxy-2,16-dimethyl-6-methylidene-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl]ethanone (PubChem CID 58233822) has the molecular formula C23H29ClO2 and a molecular weight of 372.94 g/mol. Its IUPAC name is 1-[(2S,15R,16S)-9-chloro-15-hydroxy-2,16-dimethyl-6-methylidene-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl]ethanone.
| Compound Name | 1-[(2S,15R,16S)-9-chloro-15-hydroxy-2,16-dimethyl-6-methylidene-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl]ethanone |
|---|---|
| PubChem CID | 58233822 |
| Molecular Formula | C23H29ClO2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-[(2S,15R,16S)-9-chloro-15-hydroxy-2,16-dimethyl-6-methylidene-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl]ethanone |
| SMILES | C=C1C=C2C(Cl)=CC3C(CC[C@@]4(C)C3CC[C@]4(O)C(C)=O)[C@@]2(C)C2CC12 |
| InChI | InChI=1S/C23H29ClO2/c1-12-9-19-20(24)11-15-16-6-8-23(26,13(2)25)21(16,3)7-5-17(15)22(19,4)18-10-14(12)18/h9,11,14-18,26H,1,5-8,10H2,2-4H3/t14?,15?,16?,17?,18?,21-,22-,23-/m0/s1 |
| InChIKey | JTTGSVFSVMYZLQ-WVWSUGQISA-N |
| XLogP | 5.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |