C24H29ClO5 — CID 56633654
[2-[(1S,2S,3S,5R,11R,12S,15R,16S)-9-chloro-15-hydroxy-2,16-dimethyl-6-oxo-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl]-2-oxoethyl] acetate (PubChem CID 56633654) has the molecular formula C24H29ClO5 and a molecular weight of 432.94 g/mol. Its IUPAC name is [2-[(1S,2S,3S,5R,11R,12S,15R,16S)-9-chloro-15-hydroxy-2,16-dimethyl-6-oxo-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1S,2S,3S,5R,11R,12S,15R,16S)-9-chloro-15-hydroxy-2,16-dimethyl-6-oxo-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 56633654 |
| Molecular Formula | C24H29ClO5 |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [2-[(1S,2S,3S,5R,11R,12S,15R,16S)-9-chloro-15-hydroxy-2,16-dimethyl-6-oxo-15-pentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dienyl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C=C(Cl)C4=CC(=O)[C@@H]5C[C@@H]5[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H29ClO5/c1-12(26)30-11-21(28)24(29)7-5-15-13-9-19(25)18-10-20(27)14-8-17(14)23(18,3)16(13)4-6-22(15,24)2/h9-10,13-17,29H,4-8,11H2,1-3H3/t13-,14+,15-,16-,17-,22-,23-,24-/m0/s1 |
| InChIKey | GNHMYYXUOUALTN-GQIDJPSDSA-N |
| XLogP | 3.58 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |