C22H27ClO5 — CID 70537921
(1S,2R,3S,5R,11S,12S,15R,16S,18S)-9-chloro-15,18-dihydroxy-15-(2-hydroxyacetyl)-2,16-dimethylpentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one (PubChem CID 70537921) has the molecular formula C22H27ClO5 and a molecular weight of 406.91 g/mol. Its IUPAC name is (1S,2R,3S,5R,11S,12S,15R,16S,18S)-9-chloro-15,18-dihydroxy-15-(2-hydroxyacetyl)-2,16-dimethylpentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one.
| Compound Name | (1S,2R,3S,5R,11S,12S,15R,16S,18S)-9-chloro-15,18-dihydroxy-15-(2-hydroxyacetyl)-2,16-dimethylpentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one |
|---|---|
| PubChem CID | 70537921 |
| Molecular Formula | C22H27ClO5 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (1S,2R,3S,5R,11S,12S,15R,16S,18S)-9-chloro-15,18-dihydroxy-15-(2-hydroxyacetyl)-2,16-dimethylpentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one |
| SMILES | C[C@@]12C(=CC(=O)[C@@H]3C[C@@H]31)C(Cl)=C[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO |
| InChI | InChI=1S/C22H27ClO5/c1-20-8-17(26)19-11(12(20)3-4-22(20,28)18(27)9-24)6-15(23)14-7-16(25)10-5-13(10)21(14,19)2/h6-7,10-13,17,19,24,26,28H,3-5,8-9H2,1-2H3/t10-,11+,12+,13+,17+,19-,20+,21+,22+/m1/s1 |
| InChIKey | PLTGQDDOOHIOBG-UPHUFQIOSA-N |
| XLogP | 1.98 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |