C27H32BrClO4 — CID 88791073
[(8R,9S,10S,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] 4-bromobutanoate (PubChem CID 88791073) has the molecular formula C27H32BrClO4 and a molecular weight of 535.91 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] 4-bromobutanoate.
| Compound Name | [(8R,9S,10S,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] 4-bromobutanoate |
|---|---|
| PubChem CID | 88791073 |
| Molecular Formula | C27H32BrClO4 |
| Molecular Weight | 535.91 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | [(8R,9S,10S,13S,14S,17R)-17-acetyl-6-chloro-10,13-dimethyl-1,2-dimethylidene-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-yl] 4-bromobutanoate |
| SMILES | C=C1C(=C)[C@@]2(C)C(=CC1=O)C(Cl)=C[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(OC(=O)CCCBr)C(C)=O |
| InChI | InChI=1S/C27H32BrClO4/c1-15-16(2)26(5)20-8-10-25(4)19(18(20)13-22(29)21(26)14-23(15)31)9-11-27(25,17(3)30)33-24(32)7-6-12-28/h13-14,18-20H,1-2,6-12H2,3-5H3/t18-,19-,20-,25-,26+,27-/m0/s1 |
| InChIKey | FEJZFVPLHKHEGE-TYCUADPVSA-N |
| XLogP | 6.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.91 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|