C24H32ClFO6 — CID 118643981
[(6R,8S,9S,10S,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-1-hydroxy-10-(hydroxymethyl)-13-methyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 118643981) has the molecular formula C24H32ClFO6 and a molecular weight of 470.97 g/mol. Its IUPAC name is [(6R,8S,9S,10S,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-1-hydroxy-10-(hydroxymethyl)-13-methyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(6R,8S,9S,10S,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-1-hydroxy-10-(hydroxymethyl)-13-methyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 118643981 |
| Molecular Formula | C24H32ClFO6 |
| Molecular Weight | 470.97 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | [(6R,8S,9S,10S,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-1-hydroxy-10-(hydroxymethyl)-13-methyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CCl)CC[C@H]2[C@H]3C[C@@H](F)C4=CC(=O)CC(O)[C@@]4(CO)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H32ClFO6/c1-3-21(31)32-24(20(30)11-25)7-5-15-14-10-18(26)17-8-13(28)9-19(29)23(17,12-27)16(14)4-6-22(15,24)2/h8,14-16,18-19,27,29H,3-7,9-12H2,1-2H3/t14-,15+,16+,18-,19?,22+,23+,24+/m1/s1 |
| InChIKey | SOPBPMWNPNGAJP-LQAMPOIWSA-N |
| XLogP | 2.91 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.97 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|