C25H34ClFO4 — CID 88756857
[(8R,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88756857) has the molecular formula C25H34ClFO4 and a molecular weight of 452.99 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88756857 |
| Molecular Formula | C25H34ClFO4 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-6-fluoro-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CCl)C(C)C[C@H]2[C@@H]3CC(F)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H34ClFO4/c1-5-22(30)31-25(21(29)13-26)14(2)10-18-16-12-20(27)19-11-15(28)6-8-23(19,3)17(16)7-9-24(18,25)4/h11,14,16-18,20H,5-10,12-13H2,1-4H3/t14?,16-,17+,18+,20?,23-,24+,25+/m1/s1 |
| InChIKey | UUNYJKNIAFSSNQ-ITPKZJNKSA-N |
| XLogP | 5.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|