C26H36Cl2O5 — CID 88609390
[(8S,9R,10S,13S,14S,17R)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-6,10,13,16-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88609390) has the molecular formula C26H36Cl2O5 and a molecular weight of 499.48 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,17R)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-6,10,13,16-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9R,10S,13S,14S,17R)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-6,10,13,16-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88609390 |
| Molecular Formula | C26H36Cl2O5 |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [(8S,9R,10S,13S,14S,17R)-9-chloro-17-(2-chloroacetyl)-11-hydroxy-6,10,13,16-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CCl)C(C)C[C@H]2[C@@H]3CC(C)C4=CC(=O)CC[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C26H36Cl2O5/c1-6-22(32)33-26(21(31)13-27)15(3)10-18-19-9-14(2)17-11-16(29)7-8-23(17,4)25(19,28)20(30)12-24(18,26)5/h11,14-15,18-20,30H,6-10,12-13H2,1-5H3/t14?,15?,18-,19-,20?,23-,24-,25-,26-/m0/s1 |
| InChIKey | FLDPXWREGNKGRK-FVDZXJQVSA-N |
| XLogP | 4.84 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|