C25H30Cl3FO5 — CID 88689165
[(8S,9R,10S,13S,14S,17R)-2,9-dichloro-17-(2-chloroacetyl)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88689165) has the molecular formula C25H30Cl3FO5 and a molecular weight of 535.87 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,17R)-2,9-dichloro-17-(2-chloroacetyl)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9R,10S,13S,14S,17R)-2,9-dichloro-17-(2-chloroacetyl)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88689165 |
| Molecular Formula | C25H30Cl3FO5 |
| Molecular Weight | 535.87 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | [(8S,9R,10S,13S,14S,17R)-2,9-dichloro-17-(2-chloroacetyl)-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CCl)C(C)C[C@H]2[C@@H]3CC(F)C4=CC(=O)C(Cl)=C[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C25H30Cl3FO5/c1-5-21(33)34-25(20(32)11-26)12(2)6-13-14-7-17(29)15-8-18(30)16(27)9-22(15,3)24(14,28)19(31)10-23(13,25)4/h8-9,12-14,17,19,31H,5-7,10-11H2,1-4H3/t12?,13-,14-,17?,19?,22-,23-,24-,25-/m0/s1 |
| InChIKey | QGSSPFZISSEQFM-VGLPFJBMSA-N |
| XLogP | 4.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|