C26H36BrClO5 — CID 56636184
[(6S,8S,9R,10S,13S,14S,16S,17R)-9-bromo-17-(2-chloroacetyl)-6,10,13,16-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] 3-hydroxypropanoate (PubChem CID 56636184) has the molecular formula C26H36BrClO5 and a molecular weight of 543.93 g/mol. Its IUPAC name is [(6S,8S,9R,10S,13S,14S,16S,17R)-9-bromo-17-(2-chloroacetyl)-6,10,13,16-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] 3-hydroxypropanoate.
| Compound Name | [(6S,8S,9R,10S,13S,14S,16S,17R)-9-bromo-17-(2-chloroacetyl)-6,10,13,16-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] 3-hydroxypropanoate |
|---|---|
| PubChem CID | 56636184 |
| Molecular Formula | C26H36BrClO5 |
| Molecular Weight | 543.93 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | [(6S,8S,9R,10S,13S,14S,16S,17R)-9-bromo-17-(2-chloroacetyl)-6,10,13,16-tetramethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl] 3-hydroxypropanoate |
| SMILES | C[C@H]1C[C@H]2[C@@H]3C[C@H](C)[C@](OC(=O)CCO)(C(=O)CCl)[C@@]3(C)CC[C@]2(Br)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C26H36BrClO5/c1-15-11-20-19-12-16(2)26(21(31)14-28,33-22(32)6-10-29)24(19,4)8-9-25(20,27)23(3)7-5-17(30)13-18(15)23/h13,15-16,19-20,29H,5-12,14H2,1-4H3/t15-,16-,19-,20-,23-,24-,25+,26-/m0/s1 |
| InChIKey | WLZHKONOHRSACJ-STGPXTJLSA-N |
| XLogP | 5.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.93 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|