C25H35FO5 — CID 70581907
[(8R,9R,10R,13S,14S)-2-acetyl-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 70581907) has the molecular formula C25H35FO5 and a molecular weight of 434.55 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-2-acetyl-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8R,9R,10R,13S,14S)-2-acetyl-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 70581907 |
| Molecular Formula | C25H35FO5 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-2-acetyl-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)OC1(O)C(C)C[C@H]2[C@@H]3CC(F)C4=CC(=O)C(C(C)=O)C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H35FO5/c1-6-22(29)31-25(30)13(2)9-18-15-10-20(26)19-11-21(28)16(14(3)27)12-23(19,4)17(15)7-8-24(18,25)5/h11,13,15-18,20,30H,6-10,12H2,1-5H3/t13?,15-,16?,17-,18+,20?,23-,24+,25?/m1/s1 |
| InChIKey | GWLVUGBHNJNMOF-QHLOGCGSSA-N |
| XLogP | 4.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|