C24H36O3 — CID 125124475
[(8R,9S,10R,13R,14R,17R)-3-ethoxy-13,17-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 125124475) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(8R,9S,10R,13R,14R,17R)-3-ethoxy-13,17-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8R,9S,10R,13R,14R,17R)-3-ethoxy-13,17-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 125124475 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [(8R,9S,10R,13R,14R,17R)-3-ethoxy-13,17-dimethyl-2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCOC1=CC2=CC[C@@H]3[C@H](CC[C@]4(C)[C@@H]3CC[C@@]4(C)OC(=O)CC)[C@H]2CC1 |
| InChI | InChI=1S/C24H36O3/c1-5-22(25)27-24(4)14-12-21-20-9-7-16-15-17(26-6-2)8-10-18(16)19(20)11-13-23(21,24)3/h7,15,18-21H,5-6,8-14H2,1-4H3/t18-,19+,20+,21+,23+,24+/m0/s1 |
| InChIKey | BMRFXSRZXNRFQD-RUHLZPOJSA-N |
| XLogP | 5.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |