C23H30O2 — CID 118982456
(8R,13S,17R)-13-ethyl-17-ethynyl-3-methoxy-16-methylidene-1,2,7,8,9,10,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 118982456) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (8R,13S,17R)-13-ethyl-17-ethynyl-3-methoxy-16-methylidene-1,2,7,8,9,10,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,13S,17R)-13-ethyl-17-ethynyl-3-methoxy-16-methylidene-1,2,7,8,9,10,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 118982456 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (8R,13S,17R)-13-ethyl-17-ethynyl-3-methoxy-16-methylidene-1,2,7,8,9,10,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C#C[C@]1(O)C(=C)CC2[C@@H]3CC=C4C=C(OC)CCC4C3CC[C@@]21CC |
| InChI | InChI=1S/C23H30O2/c1-5-22-12-11-19-18-10-8-17(25-4)14-16(18)7-9-20(19)21(22)13-15(3)23(22,24)6-2/h2,7,14,18-21,24H,3,5,8-13H2,1,4H3/t18?,19?,20-,21?,22+,23+/m1/s1 |
| InChIKey | VJXSBPATAOTMTJ-ZENALAJJSA-N |
| XLogP | 4.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|