C24H34O — CID 59592640
(3S,5S,6S,7S,11R)-7-ethyl-14-methyl-6-prop-2-enylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-dien-6-ol (PubChem CID 59592640) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is (3S,5S,6S,7S,11R)-7-ethyl-14-methyl-6-prop-2-enylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-dien-6-ol.
| Compound Name | (3S,5S,6S,7S,11R)-7-ethyl-14-methyl-6-prop-2-enylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-dien-6-ol |
|---|---|
| PubChem CID | 59592640 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (3S,5S,6S,7S,11R)-7-ethyl-14-methyl-6-prop-2-enylpentacyclo[8.8.0.02,7.03,5.011,16]octadeca-14,16-dien-6-ol |
| SMILES | C=CC[C@]1(O)[C@H]2C[C@H]2C2C3CC=C4C=C(C)CC[C@@H]4C3CC[C@@]21CC |
| InChI | InChI=1S/C24H34O/c1-4-11-24(25)21-14-20(21)22-19-9-7-16-13-15(3)6-8-17(16)18(19)10-12-23(22,24)5-2/h4,7,13,17-22,25H,1,5-6,8-12,14H2,2-3H3/t17-,18?,19?,20+,21-,22?,23-,24-/m0/s1 |
| InChIKey | HZQNMVSRQWQGKZ-RFEJRSBKSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|