C24H34O4 — CID 68779015
3-[(1R,2S,3R,5R,6S,7S,10S,11R,18R)-7-ethyl-6-hydroxy-18-methyl-14-oxo-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-enyl]propanoic acid (PubChem CID 68779015) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 3-[(1R,2S,3R,5R,6S,7S,10S,11R,18R)-7-ethyl-6-hydroxy-18-methyl-14-oxo-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-enyl]propanoic acid.
| Compound Name | 3-[(1R,2S,3R,5R,6S,7S,10S,11R,18R)-7-ethyl-6-hydroxy-18-methyl-14-oxo-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-enyl]propanoic acid |
|---|---|
| PubChem CID | 68779015 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 3-[(1R,2S,3R,5R,6S,7S,10S,11R,18R)-7-ethyl-6-hydroxy-18-methyl-14-oxo-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-enyl]propanoic acid |
| SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1[C@H]1C[C@H]1[C@@]2(O)CCC(=O)O)[C@H](C)CC1=CC(=O)CC[C@@H]13 |
| InChI | InChI=1S/C24H34O4/c1-3-23-8-6-17-16-5-4-15(25)11-14(16)10-13(2)21(17)22(23)18-12-19(18)24(23,28)9-7-20(26)27/h11,13,16-19,21-22,28H,3-10,12H2,1-2H3,(H,26,27)/t13-,16+,17-,18+,19-,21-,22+,23+,24+/m1/s1 |
| InChIKey | RDVPEPMLTIADSS-URPBWAHQSA-N |
| XLogP | 4.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |