C26H34O2 — CID 58092637
(1'R,2'S,3'S,5S,5'S,7'S,10'S,11'R,18'S)-18'-cyclopropyl-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one (PubChem CID 58092637) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is (1'R,2'S,3'S,5S,5'S,7'S,10'S,11'R,18'S)-18'-cyclopropyl-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one.
| Compound Name | (1'R,2'S,3'S,5S,5'S,7'S,10'S,11'R,18'S)-18'-cyclopropyl-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one |
|---|---|
| PubChem CID | 58092637 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (1'R,2'S,3'S,5S,5'S,7'S,10'S,11'R,18'S)-18'-cyclopropyl-7'-ethylspiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one |
| SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1[C@@H]1C[C@@H]1[C@@]21C=CCO1)[C@H](C1CC1)CC1=CC(=O)CC[C@@H]13 |
| InChI | InChI=1S/C26H34O2/c1-2-25-10-8-19-18-7-6-17(27)12-16(18)13-20(15-4-5-15)23(19)24(25)21-14-22(21)26(25)9-3-11-28-26/h3,9,12,15,18-24H,2,4-8,10-11,13-14H2,1H3/t18-,19+,20-,21+,22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | ZGIHYOOAMHYOJN-HTJLZVHASA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|