C24H32O3 — CID 123992556
(3'S,5S,5'S,7'S,11'R)-7'-ethyl-17'-(hydroxymethyl)spiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-ene]-14'-one (PubChem CID 123992556) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (3'S,5S,5'S,7'S,11'R)-7'-ethyl-17'-(hydroxymethyl)spiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-ene]-14'-one.
| Compound Name | (3'S,5S,5'S,7'S,11'R)-7'-ethyl-17'-(hydroxymethyl)spiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-ene]-14'-one |
|---|---|
| PubChem CID | 123992556 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (3'S,5S,5'S,7'S,11'R)-7'-ethyl-17'-(hydroxymethyl)spiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-16-ene]-14'-one |
| SMILES | CC[C@]12CCC3C(CC(CO)=C4CC(=O)CC[C@@H]43)C1C1C[C@@H]1[C@@]21C=CCO1 |
| InChI | InChI=1S/C24H32O3/c1-2-23-8-6-17-16-5-4-15(26)11-18(16)14(13-25)10-19(17)22(23)20-12-21(20)24(23)7-3-9-27-24/h3,7,16-17,19-22,25H,2,4-6,8-13H2,1H3/t16-,17?,19?,20?,21+,22?,23+,24+/m1/s1 |
| InChIKey | WPEZEGGHIZTCRB-FFCISOGZSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|