C23H28O2 — CID 58092626
(5S,7'S,11'R)-7'-methyl-17'-methylidenespiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one (PubChem CID 58092626) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (5S,7'S,11'R)-7'-methyl-17'-methylidenespiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one.
| Compound Name | (5S,7'S,11'R)-7'-methyl-17'-methylidenespiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one |
|---|---|
| PubChem CID | 58092626 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (5S,7'S,11'R)-7'-methyl-17'-methylidenespiro[2H-furan-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene]-14'-one |
| SMILES | C=C1CC2C(CC[C@@]3(C)C2C2CC2[C@@]32C=CCO2)[C@H]2CCC(=O)C=C12 |
| InChI | InChI=1S/C23H28O2/c1-13-10-18-16(15-5-4-14(24)11-17(13)15)6-8-22(2)21(18)19-12-20(19)23(22)7-3-9-25-23/h3,7,11,15-16,18-21H,1,4-6,8-10,12H2,2H3/t15-,16?,18?,19?,20?,21?,22+,23+/m1/s1 |
| InChIKey | LXUOQPREFPETBC-LDFYRPDTSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|