C19H26O — CID 149159056
(8R,9S,10R,13S,14S)-13-methyl-6-methylidene-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 149159056) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-13-methyl-6-methylidene-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-13-methyl-6-methylidene-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 149159056 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (8R,9S,10R,13S,14S)-13-methyl-6-methylidene-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C[C@@H]2[C@H](CC[C@]3(C)CCC[C@@H]23)[C@H]2CCC(=O)C=C12 |
| InChI | InChI=1S/C19H26O/c1-12-10-17-15(14-6-5-13(20)11-16(12)14)7-9-19(2)8-3-4-18(17)19/h11,14-15,17-18H,1,3-10H2,2H3/t14-,15-,17-,18+,19+/m1/s1 |
| InChIKey | NEDICOGEGOSJBV-LIEJCIORSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |