C22H28O3 — CID 88984992
(10R,13S,17R)-13-methyl-6-methylidenespiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 88984992) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (10R,13S,17R)-13-methyl-6-methylidenespiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | (10R,13S,17R)-13-methyl-6-methylidenespiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 88984992 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (10R,13S,17R)-13-methyl-6-methylidenespiro[2,7,8,9,10,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | C=C1CC2C(CC[C@@]3(C)C2CC[C@@]32CCC(=O)O2)[C@H]2CCC(=O)C=C12 |
| InChI | InChI=1S/C22H28O3/c1-13-11-18-16(15-4-3-14(23)12-17(13)15)5-8-21(2)19(18)6-9-22(21)10-7-20(24)25-22/h12,15-16,18-19H,1,3-11H2,2H3/t15-,16?,18?,19?,21+,22-/m1/s1 |
| InChIKey | XYHHAFACJQASSH-MTISRRELSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |