C23H30O4S — CID 59409133
S-(10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-1-yl) methanethioate (PubChem CID 59409133) has the molecular formula C23H30O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is S-(10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-1-yl) methanethioate.
| Compound Name | S-(10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-1-yl) methanethioate |
|---|---|
| PubChem CID | 59409133 |
| Molecular Formula | C23H30O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | S-(10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-1-yl) methanethioate |
| SMILES | CC12C(=CC(=O)CC1SC=O)CCC1C2CCC2(C)C1CCC21CCC(=O)O1 |
| InChI | InChI=1S/C23H30O4S/c1-21-8-5-18-16(17(21)6-9-23(21)10-7-20(26)27-23)4-3-14-11-15(25)12-19(28-13-24)22(14,18)2/h11,13,16-19H,3-10,12H2,1-2H3 |
| InChIKey | OKUMIZZXXXRLLB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|