C24H34O2S2 — CID 10788189
CID 10788189 (PubChem CID 10788189) has the molecular formula C24H34O2S2 and a molecular weight of 418.67 g/mol.
| Compound Name | CID 10788189 |
|---|---|
| PubChem CID | 10788189 |
| Molecular Formula | C24H34O2S2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | — |
| SMILES | C[C@]12CCC3(C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]21CCC(=O)O1)SCCS3 |
| InChI | InChI=1S/C24H34O2S2/c1-21-11-12-24(27-13-14-28-24)15-16(21)3-4-17-18(21)5-8-22(2)19(17)6-9-23(22)10-7-20(25)26-23/h15,17-19H,3-14H2,1-2H3/t17-,18+,19+,21+,22+,23-/m1/s1 |
| InChIKey | ZNQQZJTVLFWXEQ-PZCAJWILSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|