C21H30O2 — CID 141161315
(8R,9S,10R,13S,14S,17S)-10,13-dimethylspiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,4'-oxetane]-2'-one (PubChem CID 141161315) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-10,13-dimethylspiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,4'-oxetane]-2'-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-10,13-dimethylspiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,4'-oxetane]-2'-one |
|---|---|
| PubChem CID | 141161315 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-10,13-dimethylspiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,4'-oxetane]-2'-one |
| SMILES | C[C@]12CCCC=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]21CC(=O)O1 |
| InChI | InChI=1S/C21H30O2/c1-19-10-4-3-5-14(19)6-7-15-16(19)8-11-20(2)17(15)9-12-21(20)13-18(22)23-21/h5,15-17H,3-4,6-13H2,1-2H3/t15-,16+,17+,19+,20+,21+/m1/s1 |
| InChIKey | BNMPVVXRWPSHIQ-OBQKJFGGSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|