C18H28 — CID 141221987
(8S,9S,10R,13S,14R)-10-methyl-1,2,3,6,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene (PubChem CID 141221987) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is (8S,9S,10R,13S,14R)-10-methyl-1,2,3,6,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,10R,13S,14R)-10-methyl-1,2,3,6,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 141221987 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (8S,9S,10R,13S,14R)-10-methyl-1,2,3,6,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12CCCC=C1CC[C@H]1[C@@H]3CCC[C@H]3CC[C@@H]12 |
| InChI | InChI=1S/C18H28/c1-18-12-3-2-6-14(18)9-10-16-15-7-4-5-13(15)8-11-17(16)18/h6,13,15-17H,2-5,7-12H2,1H3/t13-,15+,16-,17-,18-/m0/s1 |
| InChIKey | DWSWGVHKHPJTGD-ITWBUVANSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|