C22H30F2O — CID 154288346
1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,3-difluoroprop-2-en-1-one (PubChem CID 154288346) has the molecular formula C22H30F2O and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,3-difluoroprop-2-en-1-one.
| Compound Name | 1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,3-difluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 154288346 |
| Molecular Formula | C22H30F2O |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3,3-difluoroprop-2-en-1-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CCCC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)C=C(F)F |
| InChI | InChI=1S/C22H30F2O/c1-21-11-4-3-5-14(21)6-7-15-16-8-9-18(19(25)13-20(23)24)22(16,2)12-10-17(15)21/h5,13,15-18H,3-4,6-12H2,1-2H3/t15-,16-,17-,18+,21-,22-/m0/s1 |
| InChIKey | BESAUFORIDPGOS-VABCKDIBSA-N |
| XLogP | 6.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|