C22H28F2O2 — CID 154109681
(8S,9S,10R,13S,14S,17S)-17-(3,3-difluoroprop-2-enoyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154109681) has the molecular formula C22H28F2O2 and a molecular weight of 362.46 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-17-(3,3-difluoroprop-2-enoyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-17-(3,3-difluoroprop-2-enoyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154109681 |
| Molecular Formula | C22H28F2O2 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-17-(3,3-difluoroprop-2-enoyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)C=C(F)F |
| InChI | InChI=1S/C22H28F2O2/c1-21-9-7-14(25)11-13(21)3-4-15-16-5-6-18(19(26)12-20(23)24)22(16,2)10-8-17(15)21/h11-12,15-18H,3-10H2,1-2H3/t15-,16-,17-,18+,21-,22-/m0/s1 |
| InChIKey | ZWPWUXCYQUSCLG-VABCKDIBSA-N |
| XLogP | 5.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|