C24H36N2 — CID 57143058
5-[(8S,9S,10R,13S,14R,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,2-dimethylimidazole (PubChem CID 57143058) has the molecular formula C24H36N2 and a molecular weight of 352.57 g/mol. Its IUPAC name is 5-[(8S,9S,10R,13S,14R,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,2-dimethylimidazole.
| Compound Name | 5-[(8S,9S,10R,13S,14R,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,2-dimethylimidazole |
|---|---|
| PubChem CID | 57143058 |
| Molecular Formula | C24H36N2 |
| Molecular Weight | 352.57 g/mol |
| Exact Mass | 352.29 |
| IUPAC Name | 5-[(8S,9S,10R,13S,14R,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,2-dimethylimidazole |
| SMILES | Cc1ncc([C@@H]2CC[C@@H]3[C@@H]4CCC5=CCCC[C@]5(C)[C@H]4CC[C@@]32C)n1C |
| InChI | InChI=1S/C24H36N2/c1-16-25-15-22(26(16)4)21-11-10-19-18-9-8-17-7-5-6-13-23(17,2)20(18)12-14-24(19,21)3/h7,15,18-21H,5-6,8-14H2,1-4H3/t18-,19+,20-,21-,23-,24-/m0/s1 |
| InChIKey | CSBLECYSHIZUOL-HHNLCZHGSA-N |
| XLogP | 6.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|