C26H41N — CID 154398110
2-[1-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-5-methyl-3,4-dihydro-2H-pyrrole (PubChem CID 154398110) has the molecular formula C26H41N and a molecular weight of 367.62 g/mol. Its IUPAC name is 2-[1-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-5-methyl-3,4-dihydro-2H-pyrrole.
| Compound Name | 2-[1-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-5-methyl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 154398110 |
| Molecular Formula | C26H41N |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | 2-[1-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-5-methyl-3,4-dihydro-2H-pyrrole |
| SMILES | CC1=NC(C(C)[C@H]2CC[C@H]3[C@@H]4CCC5=CCCC[C@]5(C)[C@H]4CC[C@]23C)CC1 |
| InChI | InChI=1S/C26H41N/c1-17-8-13-24(27-17)18(2)21-11-12-22-20-10-9-19-7-5-6-15-25(19,3)23(20)14-16-26(21,22)4/h7,18,20-24H,5-6,8-16H2,1-4H3/t18?,20-,21+,22-,23-,24?,25-,26+/m0/s1 |
| InChIKey | TTYPCSXUWXXMBF-HNAFSCGRSA-N |
| XLogP | 7.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|