C26H38O3 — CID 172702260
ethyl (E,4R)-4-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-oxopent-2-enoate (PubChem CID 172702260) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-oxopent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-oxopent-2-enoate |
|---|---|
| PubChem CID | 172702260 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | ethyl (E,4R)-4-[(8S,9S,10R,13S,14S,17R)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-oxopent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H38O3/c1-4-29-24(28)13-8-18(17-27)21-11-12-22-20-10-9-19-7-5-6-15-25(19,2)23(20)14-16-26(21,22)3/h7-8,13,17-18,20-23H,4-6,9-12,14-16H2,1-3H3/b13-8+/t18-,20-,21+,22-,23-,25-,26+/m0/s1 |
| InChIKey | DCRYZDTXIQEJSI-JAJXAWCZSA-N |
| XLogP | 5.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|