C24H33N — CID 57268131
2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine (PubChem CID 57268131) has the molecular formula C24H33N and a molecular weight of 335.53 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine.
| Compound Name | 2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine |
|---|---|
| PubChem CID | 57268131 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CCCC[C@@]43C)[C@@H]1CC[C@@H]2c1ccccn1 |
| InChI | InChI=1S/C24H33N/c1-23-14-5-3-7-17(23)9-10-18-19-11-12-21(22-8-4-6-16-25-22)24(19,2)15-13-20(18)23/h4,6-8,16,18-21H,3,5,9-15H2,1-2H3/t18-,19-,20-,21+,23-,24-/m0/s1 |
| InChIKey | PWTKROIDLQAMQB-OCCJOITDSA-N |
| XLogP | 6.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|