C23H32O3 — CID 143291110
(10S,13S,17R)-9,10,13-trimethylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 143291110) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (10S,13S,17R)-9,10,13-trimethylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | (10S,13S,17R)-9,10,13-trimethylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 143291110 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (10S,13S,17R)-9,10,13-trimethylspiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | CC12CC[C@@]3(C)C(CC[C@@]34CCC(=O)O4)C1CCC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C23H32O3/c1-20-9-6-16(24)14-15(20)4-5-17-18-7-10-23(11-8-19(25)26-23)22(18,3)13-12-21(17,20)2/h14,17-18H,4-13H2,1-3H3/t17?,18?,20-,21?,22-,23+/m0/s1 |
| InChIKey | ITYFWAVGMSFJMT-TVNYRGQCSA-N |
| XLogP | 4.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |