C23H27NO3 — CID 23257018
(7R,8R,10S,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carbonitrile (PubChem CID 23257018) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is (7R,8R,10S,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carbonitrile.
| Compound Name | (7R,8R,10S,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carbonitrile |
|---|---|
| PubChem CID | 23257018 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (7R,8R,10S,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carbonitrile |
| SMILES | C[C@]12CCC(=O)C=C1C[C@@H](C#N)[C@@H]1C2=CC[C@@]2(C)[C@H]1CC[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C23H27NO3/c1-21-7-3-16(25)12-15(21)11-14(13-24)20-17(21)4-8-22(2)18(20)5-9-23(22)10-6-19(26)27-23/h4,12,14,18,20H,3,5-11H2,1-2H3/t14-,18-,20+,21-,22-,23+/m0/s1 |
| InChIKey | WNGVOIAMSWIYGK-ISOGPELESA-N |
| XLogP | 4.26 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|