C26H37NO3S — CID 143419638
(7R,13S)-7-[2-(dimethylamino)ethylsulfanyl]-10,13-dimethylspiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 143419638) has the molecular formula C26H37NO3S and a molecular weight of 443.65 g/mol. Its IUPAC name is (7R,13S)-7-[2-(dimethylamino)ethylsulfanyl]-10,13-dimethylspiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | (7R,13S)-7-[2-(dimethylamino)ethylsulfanyl]-10,13-dimethylspiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 143419638 |
| Molecular Formula | C26H37NO3S |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (7R,13S)-7-[2-(dimethylamino)ethylsulfanyl]-10,13-dimethylspiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | CN(C)CCS[C@@H]1CC2=CC(=O)CCC2(C)C2=CC[C@@]3(C)C(CCC34CCC(=O)O4)C21 |
| InChI | InChI=1S/C26H37NO3S/c1-24-9-5-18(28)15-17(24)16-21(31-14-13-27(3)4)23-19(24)6-10-25(2)20(23)7-11-26(25)12-8-22(29)30-26/h6,15,20-21,23H,5,7-14,16H2,1-4H3/t20?,21-,23?,24?,25+,26?/m1/s1 |
| InChIKey | XQYWVSXJZYVCHX-QUWGLWORSA-N |
| XLogP | 4.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|