C26H34O6 — CID 72659093
CID 72659093 (PubChem CID 72659093) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol.
| Compound Name | CID 72659093 |
|---|---|
| PubChem CID | 72659093 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | — |
| SMILES | COC(=O)C1C=C2CC3(CCC2(C)C2=CCC4(C)C(CCC45CCC(=O)O5)C21)OCCO3 |
| InChI | InChI=1S/C26H34O6/c1-23-10-11-26(30-12-13-31-26)15-16(23)14-17(22(28)29-3)21-18(23)4-7-24(2)19(21)5-8-25(24)9-6-20(27)32-25/h4,14,17,19,21H,5-13,15H2,1-3H3 |
| InChIKey | CBTHHJONDCZMQC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|