C26H36O7 — CID 142894735
methyl (3S,7S,11R,17R)-11-acetyloxy-3-hydroxy-10,13-dimethyl-5'-oxospiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate (PubChem CID 142894735) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is methyl (3S,7S,11R,17R)-11-acetyloxy-3-hydroxy-10,13-dimethyl-5'-oxospiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate.
| Compound Name | methyl (3S,7S,11R,17R)-11-acetyloxy-3-hydroxy-10,13-dimethyl-5'-oxospiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate |
|---|---|
| PubChem CID | 142894735 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | methyl (3S,7S,11R,17R)-11-acetyloxy-3-hydroxy-10,13-dimethyl-5'-oxospiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate |
| SMILES | COC(=O)C1C=C2C[C@@H](O)CCC2(C)C2C(OC(C)=O)CC3(C)C(CC[C@@]34CCC(=O)O4)C12 |
| InChI | InChI=1S/C26H36O7/c1-14(27)32-19-13-25(3)18(6-9-26(25)10-7-20(29)33-26)21-17(23(30)31-4)12-15-11-16(28)5-8-24(15,2)22(19)21/h12,16-19,21-22,28H,5-11,13H2,1-4H3/t16-,17?,18?,19?,21?,22?,24?,25?,26+/m0/s1 |
| InChIKey | KVUFGPJQYRTYRB-SNQDHGQISA-N |
| XLogP | 3.33 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|