C29H38O6 — CID 163745136
[(7S,8S,11R,14S)-11-hydroxy-10,13-dimethyl-7-(5-methylfuran-2-yl)-5'-oxospiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-yl] acetate (PubChem CID 163745136) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is [(7S,8S,11R,14S)-11-hydroxy-10,13-dimethyl-7-(5-methylfuran-2-yl)-5'-oxospiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-yl] acetate.
| Compound Name | [(7S,8S,11R,14S)-11-hydroxy-10,13-dimethyl-7-(5-methylfuran-2-yl)-5'-oxospiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-yl] acetate |
|---|---|
| PubChem CID | 163745136 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | [(7S,8S,11R,14S)-11-hydroxy-10,13-dimethyl-7-(5-methylfuran-2-yl)-5'-oxospiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(=C[C@@H](c3ccc(C)o3)[C@@H]3C2C(O)CC2(C)[C@H]3CCC23CCC(=O)O3)C1 |
| InChI | InChI=1S/C29H38O6/c1-16-5-6-23(33-16)20-14-18-13-19(34-17(2)30)7-10-27(18,3)26-22(31)15-28(4)21(25(20)26)8-11-29(28)12-9-24(32)35-29/h5-6,14,19-22,25-26,31H,7-13,15H2,1-4H3/t19?,20-,21-,22?,25-,26?,27?,28?,29?/m0/s1 |
| InChIKey | LLELNCSQTOHQTN-IRGPOZQSSA-N |
| XLogP | 5.22 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|