C24H34O7 — CID 142866440
methyl (3S,6R,10R,11R,13S,17R)-3,6,11-trihydroxy-10,13-dimethyl-5'-oxospiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate (PubChem CID 142866440) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is methyl (3S,6R,10R,11R,13S,17R)-3,6,11-trihydroxy-10,13-dimethyl-5'-oxospiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate.
| Compound Name | methyl (3S,6R,10R,11R,13S,17R)-3,6,11-trihydroxy-10,13-dimethyl-5'-oxospiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate |
|---|---|
| PubChem CID | 142866440 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | methyl (3S,6R,10R,11R,13S,17R)-3,6,11-trihydroxy-10,13-dimethyl-5'-oxospiro[1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate |
| SMILES | COC(=O)C1C2C(C(O)C[C@@]3(C)C2CC[C@@]32CCC(=O)O2)[C@@]2(C)CC[C@H](O)C=C2[C@@H]1O |
| InChI | InChI=1S/C24H34O7/c1-22-7-4-12(25)10-14(22)20(28)18(21(29)30-3)17-13-5-8-24(9-6-16(27)31-24)23(13,2)11-15(26)19(17)22/h10,12-13,15,17-20,25-26,28H,4-9,11H2,1-3H3/t12-,13?,15?,17?,18?,19?,20-,22-,23-,24+/m0/s1 |
| InChIKey | HXPWDARAVKBGRJ-OWLVPYTLSA-N |
| XLogP | 1.73 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|