C26H33N — CID 143203106
(17S)-10,13-dimethyl-3,3'-dimethylidenespiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,1'-cyclopentane]-7-carbonitrile (PubChem CID 143203106) has the molecular formula C26H33N and a molecular weight of 359.56 g/mol. Its IUPAC name is (17S)-10,13-dimethyl-3,3'-dimethylidenespiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,1'-cyclopentane]-7-carbonitrile.
| Compound Name | (17S)-10,13-dimethyl-3,3'-dimethylidenespiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,1'-cyclopentane]-7-carbonitrile |
|---|---|
| PubChem CID | 143203106 |
| Molecular Formula | C26H33N |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | (17S)-10,13-dimethyl-3,3'-dimethylidenespiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,1'-cyclopentane]-7-carbonitrile |
| SMILES | C=C1C=C2CC(C#N)C3C(=CCC4(C)C3CC[C@@]43CCC(=C)C3)C2(C)CC1 |
| InChI | InChI=1S/C26H33N/c1-17-5-9-24(3)20(13-17)14-19(16-27)23-21(24)7-10-25(4)22(23)8-12-26(25)11-6-18(2)15-26/h7,13,19,22-23H,1-2,5-6,8-12,14-15H2,3-4H3/t19?,22?,23?,24?,25?,26-/m1/s1 |
| InChIKey | ATGYBZYARFQJQF-IBNJLFTJSA-N |
| XLogP | 6.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|