C24H29NO4 — CID 70316020
[(3R,5S,7S,11S,18R)-18-cyano-7,11-dimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,15-dienyl]methyl methyl carbonate (PubChem CID 70316020) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is [(3R,5S,7S,11S,18R)-18-cyano-7,11-dimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,15-dienyl]methyl methyl carbonate.
| Compound Name | [(3R,5S,7S,11S,18R)-18-cyano-7,11-dimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,15-dienyl]methyl methyl carbonate |
|---|---|
| PubChem CID | 70316020 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [(3R,5S,7S,11S,18R)-18-cyano-7,11-dimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,15-dienyl]methyl methyl carbonate |
| SMILES | COC(=O)OCC1[C@H]2CC2C2C3C(=CC[C@@]21C)[C@@]1(C)CCC(=O)C=C1C[C@H]3C#N |
| InChI | InChI=1S/C24H29NO4/c1-23-6-4-15(26)9-14(23)8-13(11-25)20-18(23)5-7-24(2)19(12-29-22(27)28-3)16-10-17(16)21(20)24/h5,9,13,16-17,19-21H,4,6-8,10,12H2,1-3H3/t13-,16-,17?,19?,20?,21?,23-,24+/m0/s1 |
| InChIKey | JSMGRHSXKNVZFD-GJPLOXATSA-N |
| XLogP | 4.44 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|