C23H32O3 — CID 159420741
(10S,13S,17R)-17-hydroxy-7,10,13-trimethyl-17-propanoyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 159420741) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is (10S,13S,17R)-17-hydroxy-7,10,13-trimethyl-17-propanoyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,13S,17R)-17-hydroxy-7,10,13-trimethyl-17-propanoyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 159420741 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (10S,13S,17R)-17-hydroxy-7,10,13-trimethyl-17-propanoyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCC(=O)[C@@]1(O)CCC2C3C(=CC[C@@]21C)[C@@]1(C)CCC(=O)C=C1CC3C |
| InChI | InChI=1S/C23H32O3/c1-5-19(25)23(26)11-8-18-20-14(2)12-15-13-16(24)6-9-21(15,3)17(20)7-10-22(18,23)4/h7,13-14,18,20,26H,5-6,8-12H2,1-4H3/t14?,18?,20?,21-,22-,23-/m0/s1 |
| InChIKey | LRRCGYWMXSYYMT-IEPCVHNWSA-N |
| XLogP | 4.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|