C27H34O2 — CID 142945961
(10S,17S)-17-ethenyl-10,13,17-trimethyl-7-(5-methylfuran-2-yl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 142945961) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is (10S,17S)-17-ethenyl-10,13,17-trimethyl-7-(5-methylfuran-2-yl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,17S)-17-ethenyl-10,13,17-trimethyl-7-(5-methylfuran-2-yl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142945961 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (10S,17S)-17-ethenyl-10,13,17-trimethyl-7-(5-methylfuran-2-yl)-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C=C[C@]1(C)CCC2C3C(=CCC21C)[C@@]1(C)CCC(=O)C=C1CC3c1ccc(C)o1 |
| InChI | InChI=1S/C27H34O2/c1-6-25(3)12-10-22-24-20(23-8-7-17(2)29-23)16-18-15-19(28)9-13-26(18,4)21(24)11-14-27(22,25)5/h6-8,11,15,20,22,24H,1,9-10,12-14,16H2,2-5H3/t20?,22?,24?,25-,26+,27?/m1/s1 |
| InChIKey | SLTKJSNSHORPPD-KPYUYLFSSA-N |
| XLogP | 6.93 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|