C26H36O6 — CID 143419716
[(7R)-7-[(2-methoxyacetyl)oxymethyl]-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 143419716) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is [(7R)-7-[(2-methoxyacetyl)oxymethyl]-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(7R)-7-[(2-methoxyacetyl)oxymethyl]-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 143419716 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | [(7R)-7-[(2-methoxyacetyl)oxymethyl]-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)OC1CCC2C3C(=CCC12C)C1(C)CCC(=O)C=C1C[C@H]3COC(=O)COC |
| InChI | InChI=1S/C26H36O6/c1-5-22(28)32-21-7-6-19-24-16(14-31-23(29)15-30-4)12-17-13-18(27)8-10-25(17,2)20(24)9-11-26(19,21)3/h9,13,16,19,21,24H,5-8,10-12,14-15H2,1-4H3/t16-,19?,21?,24?,25?,26?/m0/s1 |
| InChIKey | QRQLZQCPKDLYEO-FFVPBRQZSA-N |
| XLogP | 4.18 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|