C25H32O3 — CID 56984845
2-[(8S,10S,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethynyl butanoate (PubChem CID 56984845) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is 2-[(8S,10S,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethynyl butanoate.
| Compound Name | 2-[(8S,10S,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethynyl butanoate |
|---|---|
| PubChem CID | 56984845 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2-[(8S,10S,13S,14S,17R)-10,13-dimethyl-3-oxo-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethynyl butanoate |
| SMILES | CCCC(=O)OC#C[C@@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C25H32O3/c1-4-5-23(27)28-15-12-17-7-9-21-20-8-6-18-16-19(26)10-13-25(18,3)22(20)11-14-24(17,21)2/h11,16-17,20-21H,4-10,13-14H2,1-3H3/t17-,20-,21-,24+,25-/m0/s1 |
| InChIKey | MTRWOSIXLIIXJY-DDNPLQQISA-N |
| XLogP | 5.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|