C22H29ClO3 — CID 57186090
(8S,10S,13S,14S,17S)-17-[2-chloro-1-(hydroxymethoxy)ethenyl]-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57186090) has the molecular formula C22H29ClO3 and a molecular weight of 376.92 g/mol. Its IUPAC name is (8S,10S,13S,14S,17S)-17-[2-chloro-1-(hydroxymethoxy)ethenyl]-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,17S)-17-[2-chloro-1-(hydroxymethoxy)ethenyl]-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57186090 |
| Molecular Formula | C22H29ClO3 |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (8S,10S,13S,14S,17S)-17-[2-chloro-1-(hydroxymethoxy)ethenyl]-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1C2=CC[C@]2(C)[C@@H](C(=CCl)OCO)CC[C@@H]12 |
| InChI | InChI=1S/C22H29ClO3/c1-21-9-7-15(25)11-14(21)3-4-16-17-5-6-19(20(12-23)26-13-24)22(17,2)10-8-18(16)21/h8,11-12,16-17,19,24H,3-7,9-10,13H2,1-2H3/t16-,17-,19+,21-,22-/m0/s1 |
| InChIKey | HNFASFLGJBIRSJ-KYUOHKCGSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|