C24H32O3 — CID 138605444
(10S,13S,16Z,17S)-16-ethylidene-17-(2-hydroxyacetyl)-10,13,17-trimethyl-1,2,6,7,8,12,14,15-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 138605444) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (10S,13S,16Z,17S)-16-ethylidene-17-(2-hydroxyacetyl)-10,13,17-trimethyl-1,2,6,7,8,12,14,15-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,13S,16Z,17S)-16-ethylidene-17-(2-hydroxyacetyl)-10,13,17-trimethyl-1,2,6,7,8,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 138605444 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (10S,13S,16Z,17S)-16-ethylidene-17-(2-hydroxyacetyl)-10,13,17-trimethyl-1,2,6,7,8,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C/C=C1/CC2C3CCC4=CC(=O)CC[C@]4(C)C3=CC[C@]2(C)[C@@]1(C)C(=O)CO |
| InChI | InChI=1S/C24H32O3/c1-5-15-13-20-18-7-6-16-12-17(26)8-10-22(16,2)19(18)9-11-23(20,3)24(15,4)21(27)14-25/h5,9,12,18,20,25H,6-8,10-11,13-14H2,1-4H3/b15-5-/t18?,20?,22-,23-,24+/m0/s1 |
| InChIKey | RRMPQBLLWYPMCR-OTPDWFGMSA-N |
| XLogP | 4.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|