C24H35NO3 — CID 143419655
[(10R,13S)-10,13-dimethyl-3-oxo-1,2,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] N,N-dimethylcarbamate;ethane (PubChem CID 143419655) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is [(10R,13S)-10,13-dimethyl-3-oxo-1,2,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] N,N-dimethylcarbamate;ethane.
| Compound Name | [(10R,13S)-10,13-dimethyl-3-oxo-1,2,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] N,N-dimethylcarbamate;ethane |
|---|---|
| PubChem CID | 143419655 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | [(10R,13S)-10,13-dimethyl-3-oxo-1,2,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] N,N-dimethylcarbamate;ethane |
| SMILES | CC.CN(C)C(=O)OC1CCC2C3C=CC4=CC(=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C22H29NO3.C2H6/c1-21-11-9-15(24)13-14(21)5-6-16-17-7-8-19(26-20(25)23(3)4)22(17,2)12-10-18(16)21;1-2/h5-6,10,13,16-17,19H,7-9,11-12H2,1-4H3;1-2H3/t16?,17?,19?,21-,22-;/m0./s1 |
| InChIKey | BOJYQTIYFTXCRS-FVMOBMLQSA-N |
| XLogP | 5.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|