C23H28O6 — CID 141078425
2-[[(8S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-2,8,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]propanedioic acid (PubChem CID 141078425) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 2-[[(8S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-2,8,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]propanedioic acid.
| Compound Name | 2-[[(8S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-2,8,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 141078425 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[[(8S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-3-oxo-2,8,12,14,15,16-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]methyl]propanedioic acid |
| SMILES | C[C@]12CCC(=O)C=C1C=C[C@@H]1C2=CC[C@@]2(C)[C@H]1CC[C@]2(O)CC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C23H28O6/c1-21-8-5-14(24)11-13(21)3-4-15-17(21)6-9-22(2)18(15)7-10-23(22,29)12-16(19(25)26)20(27)28/h3-4,6,11,15-16,18,29H,5,7-10,12H2,1-2H3,(H,25,26)(H,27,28)/t15-,18+,21+,22+,23+/m1/s1 |
| InChIKey | SGQPUFDOPWYTJY-FUEMBBSISA-N |
| XLogP | 3.12 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|